C17H18N6O3S — CID 46638081
4-ethyl-N'-(4-oxo-3-propylphthalazine-1-carbonyl)thiadiazole-5-carbohydrazide (PubChem CID 46638081) has the molecular formula C17H18N6O3S and a molecular weight of 386.44 g/mol. Its IUPAC name is 4-ethyl-N'-(4-oxo-3-propylphthalazine-1-carbonyl)thiadiazole-5-carbohydrazide.
| Compound Name | 4-ethyl-N'-(4-oxo-3-propylphthalazine-1-carbonyl)thiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 46638081 |
| Molecular Formula | C17H18N6O3S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-ethyl-N'-(4-oxo-3-propylphthalazine-1-carbonyl)thiadiazole-5-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)c2snnc2CC)c2ccccc2c1=O |
| InChI | InChI=1S/C17H18N6O3S/c1-3-9-23-17(26)11-8-6-5-7-10(11)13(21-23)15(24)19-20-16(25)14-12(4-2)18-22-27-14/h5-8H,3-4,9H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | VBKJYZYGOBEUTB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|