C21H18N4O4 — CID 8839224
N'-(1-benzofuran-2-carbonyl)-4-oxo-3-propylphthalazine-1-carbohydrazide (PubChem CID 8839224) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is N'-(1-benzofuran-2-carbonyl)-4-oxo-3-propylphthalazine-1-carbohydrazide.
| Compound Name | N'-(1-benzofuran-2-carbonyl)-4-oxo-3-propylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 8839224 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N'-(1-benzofuran-2-carbonyl)-4-oxo-3-propylphthalazine-1-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)c2cc3ccccc3o2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H18N4O4/c1-2-11-25-21(28)15-9-5-4-8-14(15)18(24-25)20(27)23-22-19(26)17-12-13-7-3-6-10-16(13)29-17/h3-10,12H,2,11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | OJHPKMZUUXYJNX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|