C26H18N4O5 — CID 4995460
3-benzyl-4-oxo-N'-(2-oxochromene-3-carbonyl)phthalazine-1-carbohydrazide (PubChem CID 4995460) has the molecular formula C26H18N4O5 and a molecular weight of 466.45 g/mol. Its IUPAC name is 3-benzyl-4-oxo-N'-(2-oxochromene-3-carbonyl)phthalazine-1-carbohydrazide.
| Compound Name | 3-benzyl-4-oxo-N'-(2-oxochromene-3-carbonyl)phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 4995460 |
| Molecular Formula | C26H18N4O5 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-benzyl-4-oxo-N'-(2-oxochromene-3-carbonyl)phthalazine-1-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C26H18N4O5/c31-23(20-14-17-10-4-7-13-21(17)35-26(20)34)27-28-24(32)22-18-11-5-6-12-19(18)25(33)30(29-22)15-16-8-2-1-3-9-16/h1-14H,15H2,(H,27,31)(H,28,32) |
| InChIKey | GETFWOKEDNSYEH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|