C21H17N5O4 — CID 34057526
N'-(3-benzyl-4-oxophthalazine-1-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide (PubChem CID 34057526) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is N'-(3-benzyl-4-oxophthalazine-1-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(3-benzyl-4-oxophthalazine-1-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 34057526 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N'-(3-benzyl-4-oxophthalazine-1-carbonyl)-3-methyl-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)on1 |
| InChI | InChI=1S/C21H17N5O4/c1-13-11-17(30-25-13)19(27)22-23-20(28)18-15-9-5-6-10-16(15)21(29)26(24-18)12-14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | XOLHMEHXFKDXMG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|