C26H25N3O5 — CID 41261547
3-benzyl-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide (PubChem CID 41261547) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-benzyl-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide.
| Compound Name | 3-benzyl-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 41261547 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-benzyl-4-oxo-N-[(3,4,5-trimethoxyphenyl)methyl]phthalazine-1-carboxamide |
| SMILES | COc1cc(CNC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H25N3O5/c1-32-21-13-18(14-22(33-2)24(21)34-3)15-27-25(30)23-19-11-7-8-12-20(19)26(31)29(28-23)16-17-9-5-4-6-10-17/h4-14H,15-16H2,1-3H3,(H,27,30) |
| InChIKey | ZDXQMMKLRDPUBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |