C29H24N4O4 — CID 55800603
3-benzyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-oxophthalazine-1-carboxamide (PubChem CID 55800603) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is 3-benzyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55800603 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-benzyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-oxophthalazine-1-carboxamide |
| SMILES | COc1cccc(Oc2ccc(CNC(=O)c3nn(Cc4ccccc4)c(=O)c4ccccc34)cn2)c1 |
| InChI | InChI=1S/C29H24N4O4/c1-36-22-10-7-11-23(16-22)37-26-15-14-21(17-30-26)18-31-28(34)27-24-12-5-6-13-25(24)29(35)33(32-27)19-20-8-3-2-4-9-20/h2-17H,18-19H2,1H3,(H,31,34) |
| InChIKey | RDVWCPZDQSEJRM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |