C23H23ClN2O5 — CID 55800500
3-chloro-4-ethoxy-5-methoxy-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 55800500) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55800500 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NCc2ccc(Oc3cccc(OC)c3)nc2)cc1OC |
| InChI | InChI=1S/C23H23ClN2O5/c1-4-30-22-19(24)10-16(11-20(22)29-3)23(27)26-14-15-8-9-21(25-13-15)31-18-7-5-6-17(12-18)28-2/h5-13H,4,14H2,1-3H3,(H,26,27) |
| InChIKey | GWXNNTKFMXDNQW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |