C24H27N3O5S — CID 55800855
N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 55800855) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55800855 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | COc1cccc(Oc2ccc(CNC(=O)c3ccc(S(=O)(=O)N(C)C(C)C)cc3)cn2)c1 |
| InChI | InChI=1S/C24H27N3O5S/c1-17(2)27(3)33(29,30)22-11-9-19(10-12-22)24(28)26-16-18-8-13-23(25-15-18)32-21-7-5-6-20(14-21)31-4/h5-15,17H,16H2,1-4H3,(H,26,28) |
| InChIKey | MDXQXOPKSKJMED-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |