C19H20N4O3 — CID 78901654
5-ethyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1H-pyrazole-3-carboxamide (PubChem CID 78901654) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 5-ethyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-ethyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78901654 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 5-ethyl-N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCc1cc(C(=O)NCc2ccc(Oc3cccc(OC)c3)nc2)n[nH]1 |
| InChI | InChI=1S/C19H20N4O3/c1-3-14-9-17(23-22-14)19(24)21-12-13-7-8-18(20-11-13)26-16-6-4-5-15(10-16)25-2/h4-11H,3,12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | AGCMNDHYSHRCLC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |