C26H24N4O5 — CID 6906870
3-benzyl-4-oxo-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]phthalazine-1-carboxamide (PubChem CID 6906870) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 3-benzyl-4-oxo-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]phthalazine-1-carboxamide.
| Compound Name | 3-benzyl-4-oxo-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 6906870 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-benzyl-4-oxo-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]phthalazine-1-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/NC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C26H24N4O5/c1-33-21-14-23(35-3)22(34-2)13-18(21)15-27-28-25(31)24-19-11-7-8-12-20(19)26(32)30(29-24)16-17-9-5-4-6-10-17/h4-15H,16H2,1-3H3,(H,28,31)/b27-15+ |
| InChIKey | PCLGYHIDARJGHS-JFLMPSFJSA-N |
| XLogP | 3.23 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|