C26H19FN4O4 — CID 25494783
3-benzyl-N'-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)-4-oxophthalazine-1-carbohydrazide (PubChem CID 25494783) has the molecular formula C26H19FN4O4 and a molecular weight of 470.46 g/mol. Its IUPAC name is 3-benzyl-N'-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-benzyl-N'-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 25494783 |
| Molecular Formula | C26H19FN4O4 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-benzyl-N'-(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)oc2ccc(F)cc12 |
| InChI | InChI=1S/C26H19FN4O4/c1-15-20-13-17(27)11-12-21(20)35-23(15)25(33)29-28-24(32)22-18-9-5-6-10-19(18)26(34)31(30-22)14-16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | JGDRYLGCSKVNRD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|