C20H15BrN4O4 — CID 3891002
N'-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 3891002) has the molecular formula C20H15BrN4O4 and a molecular weight of 455.27 g/mol. Its IUPAC name is N'-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 3891002 |
| Molecular Formula | C20H15BrN4O4 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | N'-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2nn(C)c(=O)c3ccccc23)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C20H15BrN4O4/c1-10-14-9-11(21)7-8-15(14)29-17(10)19(27)23-22-18(26)16-12-5-3-4-6-13(12)20(28)25(2)24-16/h3-9H,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | GJGPDSHGWCZJTN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|