C16H12BrN3O2 — CID 3525242
N-(3-bromophenyl)-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 3525242) has the molecular formula C16H12BrN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(3-bromophenyl)-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 3525242 |
| Molecular Formula | C16H12BrN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-(3-bromophenyl)-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2cccc(Br)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C16H12BrN3O2/c1-20-16(22)13-8-3-2-7-12(13)14(19-20)15(21)18-11-6-4-5-10(17)9-11/h2-9H,1H3,(H,18,21) |
| InChIKey | XSHZOCGGGXZFDT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |