C18H16N4O5S — CID 26873192
3-methyl-N'-(4-methylsulfonylbenzoyl)-4-oxophthalazine-1-carbohydrazide (PubChem CID 26873192) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is 3-methyl-N'-(4-methylsulfonylbenzoyl)-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-N'-(4-methylsulfonylbenzoyl)-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26873192 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3-methyl-N'-(4-methylsulfonylbenzoyl)-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)c2ccc(S(C)(=O)=O)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H16N4O5S/c1-22-18(25)14-6-4-3-5-13(14)15(21-22)17(24)20-19-16(23)11-7-9-12(10-8-11)28(2,26)27/h3-10H,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | PHJSUKSSKGVZNN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|