C17H21N5O4 — CID 51552973
N-[(2R)-3-methyl-1-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxobutan-2-yl]acetamide (PubChem CID 51552973) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[(2R)-3-methyl-1-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2R)-3-methyl-1-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 51552973 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(2R)-3-methyl-1-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-1-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C(=O)NNC(=O)c1nn(C)c(=O)c2ccccc12)C(C)C |
| InChI | InChI=1S/C17H21N5O4/c1-9(2)13(18-10(3)23)15(24)19-20-16(25)14-11-7-5-6-8-12(11)17(26)22(4)21-14/h5-9,13H,1-4H3,(H,18,23)(H,19,24)(H,20,25)/t13-/m1/s1 |
| InChIKey | DVPOIFCVWMPIDM-CYBMUJFWSA-N |
| XLogP | -0.14 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|