C20H18N6O3S — CID 24684809
N'-[2-(1,3-benzothiazol-2-ylamino)propanoyl]-3-methyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 24684809) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylamino)propanoyl]-3-methyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylamino)propanoyl]-3-methyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 24684809 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylamino)propanoyl]-3-methyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CC(Nc1nc2ccccc2s1)C(=O)NNC(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H18N6O3S/c1-11(21-20-22-14-9-5-6-10-15(14)30-20)17(27)23-24-18(28)16-12-7-3-4-8-13(12)19(29)26(2)25-16/h3-11H,1-2H3,(H,21,22)(H,23,27)(H,24,28) |
| InChIKey | XTVUMIYGWHFPHH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|