C18H17ClN4O2S — CID 40812478
(2S)-2-(1,3-benzothiazol-2-ylamino)-N'-[2-(2-chlorophenyl)acetyl]propanehydrazide (PubChem CID 40812478) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-ylamino)-N'-[2-(2-chlorophenyl)acetyl]propanehydrazide.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-N'-[2-(2-chlorophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 40812478 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-ylamino)-N'-[2-(2-chlorophenyl)acetyl]propanehydrazide |
| SMILES | C[C@H](Nc1nc2ccccc2s1)C(=O)NNC(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN4O2S/c1-11(20-18-21-14-8-4-5-9-15(14)26-18)17(25)23-22-16(24)10-12-6-2-3-7-13(12)19/h2-9,11H,10H2,1H3,(H,20,21)(H,22,24)(H,23,25)/t11-/m0/s1 |
| InChIKey | YTMULVCWWIRFQZ-NSHDSACASA-N |
| XLogP | 3.14 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|