C16H21N5O3S2 — CID 8564720
methyl 4-[[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]carbamothioylamino]butanoate (PubChem CID 8564720) has the molecular formula C16H21N5O3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is methyl 4-[[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 8564720 |
| Molecular Formula | C16H21N5O3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | methyl 4-[[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)NNC(=O)[C@H](C)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H21N5O3S2/c1-10(18-16-19-11-6-3-4-7-12(11)26-16)14(23)20-21-15(25)17-9-5-8-13(22)24-2/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,18,19)(H,20,23)(H2,17,21,25)/t10-/m0/s1 |
| InChIKey | PCMROWWBGWABSI-JTQLQIEISA-N |
| XLogP | 1.55 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|