C18H18FN5OS2 — CID 8564743
1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 8564743) has the molecular formula C18H18FN5OS2 and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8564743 |
| Molecular Formula | C18H18FN5OS2 |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)[C@H](C)Nc2nc3ccccc3s2)cc1F |
| InChI | InChI=1S/C18H18FN5OS2/c1-10-7-8-12(9-13(10)19)21-17(26)24-23-16(25)11(2)20-18-22-14-5-3-4-6-15(14)27-18/h3-9,11H,1-2H3,(H,20,22)(H,23,25)(H2,21,24,26)/t11-/m0/s1 |
| InChIKey | CKKYSIUAGAOJOR-NSHDSACASA-N |
| XLogP | 3.56 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|