C18H19N5OS2 — CID 8564604
1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2-methylphenyl)thiourea (PubChem CID 8564604) has the molecular formula C18H19N5OS2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8564604 |
| Molecular Formula | C18H19N5OS2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)NNC(=O)[C@H](C)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H19N5OS2/c1-11-7-3-4-8-13(11)20-17(25)23-22-16(24)12(2)19-18-21-14-9-5-6-10-15(14)26-18/h3-10,12H,1-2H3,(H,19,21)(H,22,24)(H2,20,23,25)/t12-/m0/s1 |
| InChIKey | CLYRVCNAFLKSRZ-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|