C19H21N5OS2 — CID 8564684
1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 8564684) has the molecular formula C19H21N5OS2 and a molecular weight of 399.55 g/mol. Its IUPAC name is 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 8564684 |
| Molecular Formula | C19H21N5OS2 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NNC(=O)[C@H](C)Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H21N5OS2/c1-11-8-9-12(2)15(10-11)21-18(26)24-23-17(25)13(3)20-19-22-14-6-4-5-7-16(14)27-19/h4-10,13H,1-3H3,(H,20,22)(H,23,25)(H2,21,24,26)/t13-/m0/s1 |
| InChIKey | IPFPIXHJRBBRHF-ZDUSSCGKSA-N |
| XLogP | 3.73 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|