methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate

C11H12N2O2S — CID 6991162

IUPACmethyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate
SMILESCOC(=O)[C@H](C)Nc1nc2ccccc2s1
InChIInChI=1S/C11H12N2O2S/c1-7(10(14)15-2)12-11-13-8-5-3-4-6-9(8)16-11/h3-7H,1-2H3,(H,12,13)/t7-/m0/s1
InChIKeyVQAJTLVVHHOXGQ-ZETCQYMHSA-N
MW236.30 g/mol
LogP2.27
Rot. Bonds3

About methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate

methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate (PubChem CID 6991162) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate.

Molecular Properties

Compound Namemethyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate
PubChem CID6991162
Molecular FormulaC11H12N2O2S
Molecular Weight236.30 g/mol
Exact Mass236.06
IUPAC Namemethyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate
SMILESCOC(=O)[C@H](C)Nc1nc2ccccc2s1
InChIInChI=1S/C11H12N2O2S/c1-7(10(14)15-2)12-11-13-8-5-3-4-6-9(8)16-11/h3-7H,1-2H3,(H,12,13)/t7-/m0/s1
InChIKeyVQAJTLVVHHOXGQ-ZETCQYMHSA-N
XLogP2.27
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.30
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate?
The IUPAC name of methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate (CID 6991162) is methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate.
What is the SMILES notation for methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate?
The canonical SMILES for methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate is COC(=O)[C@H](C)Nc1nc2ccccc2s1.
What is the InChIKey of methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate?
The InChIKey is VQAJTLVVHHOXGQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-7(10(14)15-2)12-11-13-8-5-3-4-6-9(8)16-11/h3-7H,1-2H3,(H,12,13)/t7-/m0/s1.
What are the key properties of methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate?
methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate has a molecular weight of 236.30 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(1,3-benzothiazol-2-ylamino)propanoate is sourced from PubChem (CID 6991162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).