C11H11NO2S2 — CID 7034825
methyl (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoate (PubChem CID 7034825) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoate.
| Compound Name | methyl (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 7034825 |
| Molecular Formula | C11H11NO2S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | methyl (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoate |
| SMILES | COC(=O)[C@H](C)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11NO2S2/c1-7(10(13)14-2)15-11-12-8-5-3-4-6-9(8)16-11/h3-7H,1-2H3/t7-/m0/s1 |
| InChIKey | OFADSZGZEXEZIB-ZETCQYMHSA-N |
| XLogP | 2.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |