C17H15N3O3S2 — CID 97249038
N'-[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]-2-hydroxybenzohydrazide (PubChem CID 97249038) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N'-[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 97249038 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N'-[(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]-2-hydroxybenzohydrazide |
| SMILES | C[C@H](Sc1nc2ccccc2s1)C(=O)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C17H15N3O3S2/c1-10(24-17-18-12-7-3-5-9-14(12)25-17)15(22)19-20-16(23)11-6-2-4-8-13(11)21/h2-10,21H,1H3,(H,19,22)(H,20,23)/t10-/m0/s1 |
| InChIKey | PVKTZQRYVFNVCG-JTQLQIEISA-N |
| XLogP | 2.94 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|