C19H17N3O3S2 — CID 27522233
2-[(E)-N-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-C-methylcarbonimidoyl]benzoic acid (PubChem CID 27522233) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[(E)-N-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-C-methylcarbonimidoyl]benzoic acid.
| Compound Name | 2-[(E)-N-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-C-methylcarbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 27522233 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-[(E)-N-[[(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)propanoyl]amino]-C-methylcarbonimidoyl]benzoic acid |
| SMILES | C/C(=N\NC(=O)[C@@H](C)Sc1nc2ccccc2s1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C19H17N3O3S2/c1-11(13-7-3-4-8-14(13)18(24)25)21-22-17(23)12(2)26-19-20-15-9-5-6-10-16(15)27-19/h3-10,12H,1-2H3,(H,22,23)(H,24,25)/b21-11+/t12-/m1/s1 |
| InChIKey | VGKSUQIILBLKRY-KIHMUJGBSA-N |
| XLogP | 4.02 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|