C18H17N3OS2 — CID 86771762
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(4-methylphenyl)methylideneamino]propanamide (PubChem CID 86771762) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(4-methylphenyl)methylideneamino]propanamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(4-methylphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 86771762 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(4-methylphenyl)methylideneamino]propanamide |
| SMILES | Cc1ccc(/C=N/NC(=O)C(C)Sc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H17N3OS2/c1-12-7-9-14(10-8-12)11-19-21-17(22)13(2)23-18-20-15-5-3-4-6-16(15)24-18/h3-11,13H,1-2H3,(H,21,22)/b19-11+ |
| InChIKey | FKKRNDIGHYIRPQ-YBFXNURJSA-N |
| XLogP | 4.24 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|