C18H14BrN3O3S2 — CID 4510790
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]propanamide (PubChem CID 4510790) has the molecular formula C18H14BrN3O3S2 and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]propanamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 4510790 |
| Molecular Formula | C18H14BrN3O3S2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]propanamide |
| SMILES | CC(Sc1nc2ccccc2s1)C(=O)NN=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C18H14BrN3O3S2/c1-10(26-18-21-13-4-2-3-5-16(13)27-18)17(23)22-20-8-11-6-14-15(7-12(11)19)25-9-24-14/h2-8,10H,9H2,1H3,(H,22,23) |
| InChIKey | UPDYBRNDNUUTKA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|