C11H11BrN2O4 — CID 900184
(2S)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-hydroxypropanamide (PubChem CID 900184) has the molecular formula C11H11BrN2O4 and a molecular weight of 315.12 g/mol. Its IUPAC name is (2S)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 900184 |
| Molecular Formula | C11H11BrN2O4 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | (2S)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-hydroxypropanamide |
| SMILES | C[C@H](O)C(=O)NN=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C11H11BrN2O4/c1-6(15)11(16)14-13-4-7-2-9-10(3-8(7)12)18-5-17-9/h2-4,6,15H,5H2,1H3,(H,14,16)/t6-/m0/s1 |
| InChIKey | QYTVNAXDGAUCFL-LURJTMIESA-N |
| XLogP | 1.01 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|