C17H14BrN3O6 — CID 28839102
(2R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-nitrophenoxy)propanamide (PubChem CID 28839102) has the molecular formula C17H14BrN3O6 and a molecular weight of 436.22 g/mol. Its IUPAC name is (2R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-nitrophenoxy)propanamide.
| Compound Name | (2R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 28839102 |
| Molecular Formula | C17H14BrN3O6 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | (2R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(2-nitrophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccccc1[N+](=O)[O-])C(=O)N/N=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C17H14BrN3O6/c1-10(27-14-5-3-2-4-13(14)21(23)24)17(22)20-19-8-11-6-15-16(7-12(11)18)26-9-25-15/h2-8,10H,9H2,1H3,(H,20,22)/b19-8-/t10-/m1/s1 |
| InChIKey | FTCPGBYJARGIQA-AFWYBORESA-N |
| XLogP | 3.00 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|