C18H17N3O5 — CID 10736902
N-[(E)-2,3-dihydrochromen-4-ylideneamino]-2-(2-nitrophenoxy)propanamide (PubChem CID 10736902) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[(E)-2,3-dihydrochromen-4-ylideneamino]-2-(2-nitrophenoxy)propanamide.
| Compound Name | N-[(E)-2,3-dihydrochromen-4-ylideneamino]-2-(2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 10736902 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[(E)-2,3-dihydrochromen-4-ylideneamino]-2-(2-nitrophenoxy)propanamide |
| SMILES | CC(Oc1ccccc1[N+](=O)[O-])C(=O)N/N=C1\CCOc2ccccc21 |
| InChI | InChI=1S/C18H17N3O5/c1-12(26-17-9-5-3-7-15(17)21(23)24)18(22)20-19-14-10-11-25-16-8-4-2-6-13(14)16/h2-9,12H,10-11H2,1H3,(H,20,22)/b19-14+ |
| InChIKey | ZWHUIZJBNYXYOH-XMHGGMMESA-N |
| XLogP | 2.67 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|