C18H19N3O7 — CID 9206073
(2R)-N'-[2-(2-methoxyphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide (PubChem CID 9206073) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is (2R)-N'-[2-(2-methoxyphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide.
| Compound Name | (2R)-N'-[2-(2-methoxyphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9206073 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (2R)-N'-[2-(2-methoxyphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC(=O)[C@@H](C)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O7/c1-12(28-14-8-4-3-7-13(14)21(24)25)18(23)20-19-17(22)11-27-16-10-6-5-9-15(16)26-2/h3-10,12H,11H2,1-2H3,(H,19,22)(H,20,23)/t12-/m1/s1 |
| InChIKey | YJRJZFZEGYIZFR-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|