C18H18BrN3O6 — CID 4944233
N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide (PubChem CID 4944233) has the molecular formula C18H18BrN3O6 and a molecular weight of 452.26 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide.
| Compound Name | N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 4944233 |
| Molecular Formula | C18H18BrN3O6 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N'-[2-(2-bromo-4-methylphenoxy)acetyl]-2-(2-nitrophenoxy)propanehydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)C(C)Oc2ccccc2[N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C18H18BrN3O6/c1-11-7-8-15(13(19)9-11)27-10-17(23)20-21-18(24)12(2)28-16-6-4-3-5-14(16)22(25)26/h3-9,12H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | LNMDHQRFQXOBKF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|