C12H14N2O6 — CID 60637868
methyl 2-[[2-(2-nitrophenoxy)acetyl]amino]propanoate (PubChem CID 60637868) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is methyl 2-[[2-(2-nitrophenoxy)acetyl]amino]propanoate.
| Compound Name | methyl 2-[[2-(2-nitrophenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 60637868 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl 2-[[2-(2-nitrophenoxy)acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O6/c1-8(12(16)19-2)13-11(15)7-20-10-6-4-3-5-9(10)14(17)18/h3-6,8H,7H2,1-2H3,(H,13,15) |
| InChIKey | YTRXTQISBLMLKM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|