C16H14F2N2O4 — CID 7503595
N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-nitrophenoxy)acetamide (PubChem CID 7503595) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7503595 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2-nitrophenoxy)acetamide |
| SMILES | C[C@H](NC(=O)COc1ccccc1[N+](=O)[O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14F2N2O4/c1-10(12-7-6-11(17)8-13(12)18)19-16(21)9-24-15-5-3-2-4-14(15)20(22)23/h2-8,10H,9H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | AASARMZOEOKPIL-JTQLQIEISA-N |
| XLogP | 3.13 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|