C14H22ClN3O4 — CID 119606865
N-(1-amino-2,3-dimethylbutan-2-yl)-2-(2-nitrophenoxy)acetamide;hydrochloride (PubChem CID 119606865) has the molecular formula C14H22ClN3O4 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2-(2-nitrophenoxy)acetamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-(2-nitrophenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119606865 |
| Molecular Formula | C14H22ClN3O4 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-(2-nitrophenoxy)acetamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)COc1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H21N3O4.ClH/c1-10(2)14(3,9-15)16-13(18)8-21-12-7-5-4-6-11(12)17(19)20;/h4-7,10H,8-9,15H2,1-3H3,(H,16,18);1H |
| InChIKey | KEDDAGLKEIDNDA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|