C13H21ClN4O3 — CID 119606725
2-amino-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide;hydrochloride (PubChem CID 119606725) has the molecular formula C13H21ClN4O3 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-amino-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide;hydrochloride.
| Compound Name | 2-amino-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119606725 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-amino-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)c1cccc([N+](=O)[O-])c1N.Cl |
| InChI | InChI=1S/C13H20N4O3.ClH/c1-8(2)13(3,7-14)16-12(18)9-5-4-6-10(11(9)15)17(19)20;/h4-6,8H,7,14-15H2,1-3H3,(H,16,18);1H |
| InChIKey | GZRYRXYOYFKBQP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|