C26H34N4O8 — CID 17233381
2-(2-nitrophenoxy)-N-[8-[2-(2-nitrophenoxy)propanoylamino]octyl]propanamide (PubChem CID 17233381) has the molecular formula C26H34N4O8 and a molecular weight of 530.58 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[8-[2-(2-nitrophenoxy)propanoylamino]octyl]propanamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[8-[2-(2-nitrophenoxy)propanoylamino]octyl]propanamide |
|---|---|
| PubChem CID | 17233381 |
| Molecular Formula | C26H34N4O8 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[8-[2-(2-nitrophenoxy)propanoylamino]octyl]propanamide |
| SMILES | CC(Oc1ccccc1[N+](=O)[O-])C(=O)NCCCCCCCCNC(=O)C(C)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H34N4O8/c1-19(37-23-15-9-7-13-21(23)29(33)34)25(31)27-17-11-5-3-4-6-12-18-28-26(32)20(2)38-24-16-10-8-14-22(24)30(35)36/h7-10,13-16,19-20H,3-6,11-12,17-18H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | FKBLDXMHSAWVEV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|