C19H22N2O4 — CID 7503731
(2R)-2-(2-nitrophenoxy)-N-[(2R)-4-phenylbutan-2-yl]propanamide (PubChem CID 7503731) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2R)-2-(2-nitrophenoxy)-N-[(2R)-4-phenylbutan-2-yl]propanamide.
| Compound Name | (2R)-2-(2-nitrophenoxy)-N-[(2R)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 7503731 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2R)-2-(2-nitrophenoxy)-N-[(2R)-4-phenylbutan-2-yl]propanamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)[C@@H](C)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O4/c1-14(12-13-16-8-4-3-5-9-16)20-19(22)15(2)25-18-11-7-6-10-17(18)21(23)24/h3-11,14-15H,12-13H2,1-2H3,(H,20,22)/t14-,15-/m1/s1 |
| InChIKey | WDJOODWPNYKHDY-HUUCEWRRSA-N |
| XLogP | 3.50 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|