C20H21ClN2O5 — CID 16958940
[1-oxo-1-(4-phenylbutan-2-ylamino)propan-2-yl] 4-chloro-2-nitrobenzoate (PubChem CID 16958940) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [1-oxo-1-(4-phenylbutan-2-ylamino)propan-2-yl] 4-chloro-2-nitrobenzoate.
| Compound Name | [1-oxo-1-(4-phenylbutan-2-ylamino)propan-2-yl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 16958940 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [1-oxo-1-(4-phenylbutan-2-ylamino)propan-2-yl] 4-chloro-2-nitrobenzoate |
| SMILES | CC(CCc1ccccc1)NC(=O)C(C)OC(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21ClN2O5/c1-13(8-9-15-6-4-3-5-7-15)22-19(24)14(2)28-20(25)17-11-10-16(21)12-18(17)23(26)27/h3-7,10-14H,8-9H2,1-2H3,(H,22,24) |
| InChIKey | SOFREEFKXKXDLH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|