C20H22ClNO4 — CID 7500079
[(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 4-chloro-2-hydroxybenzoate (PubChem CID 7500079) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7500079 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 4-chloro-2-hydroxybenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)cc1O)C(=O)N[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H22ClNO4/c1-13(8-9-15-6-4-3-5-7-15)22-19(24)14(2)26-20(25)17-11-10-16(21)12-18(17)23/h3-7,10-14,23H,8-9H2,1-2H3,(H,22,24)/t13-,14-/m0/s1 |
| InChIKey | LIVFKSWCQFBLEQ-KBPBESRZSA-N |
| XLogP | 3.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |