C20H20ClF2NO3 — CID 7382593
[(2R)-1-oxo-1-[[(2R)-4-phenylbutan-2-yl]amino]propan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7382593) has the molecular formula C20H20ClF2NO3 and a molecular weight of 395.83 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(2R)-4-phenylbutan-2-yl]amino]propan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(2R)-1-oxo-1-[[(2R)-4-phenylbutan-2-yl]amino]propan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7382593 |
| Molecular Formula | C20H20ClF2NO3 |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [(2R)-1-oxo-1-[[(2R)-4-phenylbutan-2-yl]amino]propan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)[C@@H](C)OC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H20ClF2NO3/c1-12(8-9-14-6-4-3-5-7-14)24-19(25)13(2)27-20(26)15-10-17(22)18(23)11-16(15)21/h3-7,10-13H,8-9H2,1-2H3,(H,24,25)/t12-,13-/m1/s1 |
| InChIKey | YZAPBIJUFLDMNZ-CHWSQXEVSA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|