C16H11Cl2F2NO3 — CID 2565873
[(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2565873) has the molecular formula C16H11Cl2F2NO3 and a molecular weight of 374.17 g/mol. Its IUPAC name is [(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2565873 |
| Molecular Formula | C16H11Cl2F2NO3 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | [(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(F)c(F)cc1Cl)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2F2NO3/c1-8(15(22)21-10-4-2-9(17)3-5-10)24-16(23)11-6-13(19)14(20)7-12(11)18/h2-8H,1H3,(H,21,22)/t8-/m0/s1 |
| InChIKey | BMVYIMHLOWGYDF-QMMMGPOBSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|