C18H14ClF2NO4 — CID 2565729
[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2565729) has the molecular formula C18H14ClF2NO4 and a molecular weight of 381.76 g/mol. Its IUPAC name is [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2565729 |
| Molecular Formula | C18H14ClF2NO4 |
| Molecular Weight | 381.76 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](C)OC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H14ClF2NO4/c1-9(23)11-3-5-12(6-4-11)22-17(24)10(2)26-18(25)13-7-15(20)16(21)8-14(13)19/h3-8,10H,1-2H3,(H,22,24)/t10-/m1/s1 |
| InChIKey | ZZGVPYZXCGQGID-SNVBAGLBSA-N |
| XLogP | 4.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|