C18H16FNO4 — CID 24686549
[1-(4-acetylanilino)-1-oxopropan-2-yl] 2-fluorobenzoate (PubChem CID 24686549) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is [1-(4-acetylanilino)-1-oxopropan-2-yl] 2-fluorobenzoate.
| Compound Name | [1-(4-acetylanilino)-1-oxopropan-2-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 24686549 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [1-(4-acetylanilino)-1-oxopropan-2-yl] 2-fluorobenzoate |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)OC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C18H16FNO4/c1-11(21)13-7-9-14(10-8-13)20-17(22)12(2)24-18(23)15-5-3-4-6-16(15)19/h3-10,12H,1-2H3,(H,20,22) |
| InChIKey | DDKRTXVBSNCSDT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |