C17H13F4NO3 — CID 7864203
[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-fluorobenzoate (PubChem CID 7864203) has the molecular formula C17H13F4NO3 and a molecular weight of 355.29 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-fluorobenzoate.
| Compound Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7864203 |
| Molecular Formula | C17H13F4NO3 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1F)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F4NO3/c1-10(25-16(24)13-4-2-3-5-14(13)18)15(23)22-12-8-6-11(7-9-12)17(19,20)21/h2-10H,1H3,(H,22,23)/t10-/m1/s1 |
| InChIKey | ZLBXCKSLHLLFCB-SNVBAGLBSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |