C19H19F3N2O4 — CID 7602890
[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 7602890) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 7602890 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1NCCO)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N2O4/c1-12(17(26)24-14-8-6-13(7-9-14)19(20,21)22)28-18(27)15-4-2-3-5-16(15)23-10-11-25/h2-9,12,23,25H,10-11H2,1H3,(H,24,26)/t12-/m1/s1 |
| InChIKey | OFCMBXACCCUTER-GFCCVEGCSA-N |
| XLogP | 3.29 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |