C18H28N2O4 — CID 46617983
[1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 46617983) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is [1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 46617983 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NCCO)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C18H28N2O4/c1-12(2)20(13(3)4)17(22)14(5)24-18(23)15-8-6-7-9-16(15)19-10-11-21/h6-9,12-14,19,21H,10-11H2,1-5H3 |
| InChIKey | NZYZSIMTDJPVDT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |