C19H21N3O5 — CID 7603264
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 7603264) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 7603264 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)c1ccccc1NCCO)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O5/c1-20-19(26)22-17(24)16(13-7-3-2-4-8-13)27-18(25)14-9-5-6-10-15(14)21-11-12-23/h2-10,16,21,23H,11-12H2,1H3,(H2,20,22,24,26)/t16-/m0/s1 |
| InChIKey | CAGJZMKUFZTXJP-INIZCTEOSA-N |
| XLogP | 1.44 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |