C25H26N2O4 — CID 7602871
[(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 7602871) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 7602871 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1NCCO)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4/c1-18(31-25(30)21-14-8-9-15-22(21)26-16-17-28)24(29)27-23(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-15,18,23,26,28H,16-17H2,1H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | NBJDXKUACJMLGX-SFHVURJKSA-N |
| XLogP | 3.54 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |