C24H23NO4S — CID 11927150
[(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate (PubChem CID 11927150) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate.
| Compound Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927150 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1[S@@](C)=O)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c1-17(29-24(27)20-15-9-10-16-21(20)30(2)28)23(26)25-22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-17,22H,1-2H3,(H,25,26)/t17-,30+/m0/s1 |
| InChIKey | HPXAYZJUECNPHY-NOVUIFNWSA-N |
| XLogP | 3.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |